C18H19N6+ — CID 135611816
8,13,15-trimethyl-4-phenyl-3,4,5,7,9-pentaza-2-azoniatricyclo[9.4.0.02,6]pentadeca-1(15),2,5,8,11,13-hexaene (PubChem CID 135611816) has the molecular formula C18H19N6+ and a molecular weight of 319.39 g/mol. Its IUPAC name is 8,13,15-trimethyl-4-phenyl-3,4,5,7,9-pentaza-2-azoniatricyclo[9.4.0.02,6]pentadeca-1(15),2,5,8,11,13-hexaene.
| Compound Name | 8,13,15-trimethyl-4-phenyl-3,4,5,7,9-pentaza-2-azoniatricyclo[9.4.0.02,6]pentadeca-1(15),2,5,8,11,13-hexaene |
|---|---|
| PubChem CID | 135611816 |
| Molecular Formula | C18H19N6+ |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 8,13,15-trimethyl-4-phenyl-3,4,5,7,9-pentaza-2-azoniatricyclo[9.4.0.02,6]pentadeca-1(15),2,5,8,11,13-hexaene |
| SMILES | C/C1=N/Cc2cc(C)cc(C)c2-[n+]2nn(-c3ccccc3)nc2N1 |
| InChI | InChI=1S/C18H19N6/c1-12-9-13(2)17-15(10-12)11-19-14(3)20-18-21-24(22-23(17)18)16-7-5-4-6-8-16/h4-10H,11H2,1-3H3,(H,19,20,21,22)/q+1 |
| InChIKey | ZCCNYCGTKAZBQF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|