C13H14FN3O2 — CID 135612041
2-(4-fluoroanilino)-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 135612041) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(4-fluoroanilino)-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135612041 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-(4-fluoroanilino)-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(Nc2ccc(F)cc2)[nH]c(=O)c1CCO |
| InChI | InChI=1S/C13H14FN3O2/c1-8-11(6-7-18)12(19)17-13(15-8)16-10-4-2-9(14)3-5-10/h2-5,18H,6-7H2,1H3,(H2,15,16,17,19) |
| InChIKey | DFVADMLYEGUJQS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |