C19H20N8O5S4 — CID 135612196
3-[[5-(2-aminoethylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-7-[[(2Z)-2-(6-amino-2-pyridinyl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 135612196) has the molecular formula C19H20N8O5S4 and a molecular weight of 568.69 g/mol. Its IUPAC name is 3-[[5-(2-aminoethylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-7-[[(2Z)-2-(6-amino-2-pyridinyl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-[[5-(2-aminoethylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-7-[[(2Z)-2-(6-amino-2-pyridinyl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 135612196 |
| Molecular Formula | C19H20N8O5S4 |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.04 |
| IUPAC Name | 3-[[5-(2-aminoethylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-7-[[(2Z)-2-(6-amino-2-pyridinyl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NCCSCc1nnc(SC2=C(C(=O)O)N3C(=O)C(NC(=O)/C(=N\O)c4cccc(N)n4)C3SC2)s1 |
| InChI | InChI=1S/C19H20N8O5S4/c20-4-5-33-7-11-24-25-19(36-11)35-9-6-34-17-13(16(29)27(17)14(9)18(30)31)23-15(28)12(26-32)8-2-1-3-10(21)22-8/h1-3,13,17,32H,4-7,20H2,(H2,21,22)(H,23,28)(H,30,31)/b26-12- |
| InChIKey | REAOIZZQBQVHFM-ZRGSRPPYSA-N |
| XLogP | 0.37 |
| TPSA | 210.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|