About 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid
2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid (PubChem CID 135612202) has the molecular formula C14H13N3O7S
and a molecular weight of 367.34 g/mol. Its IUPAC name is 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid.
Molecular Properties
| Compound Name | 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid |
| PubChem CID | 135612202 |
| Molecular Formula | C14H13N3O7S |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid |
| SMILES | Cc1cc(=O)n(C)c(O)c1/N=N/c1cc(SOOO)ccc1C(=O)O |
| InChI | InChI=1S/C14H13N3O7S/c1-7-5-11(18)17(2)13(19)12(7)16-15-10-6-8(25-24-23-22)3-4-9(10)14(20)21/h3-6,19,22H,1-2H3,(H,20,21)/b16-15+ |
| InChIKey | XZCDNLMYPQNWDP-FOCLMDBBSA-N |
| XLogP | 2.94 |
| TPSA | 142.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid?
The IUPAC name of 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid (CID 135612202) is 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid.
What is the SMILES notation for 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid?
The canonical SMILES for 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid is Cc1cc(=O)n(C)c(O)c1/N=N/c1cc(SOOO)ccc1C(=O)O.
What is the InChIKey of 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid?
The InChIKey is XZCDNLMYPQNWDP-FOCLMDBBSA-N. The full InChI is InChI=1S/C14H13N3O7S/c1-7-5-11(18)17(2)13(19)12(7)16-15-10-6-8(25-24-23-22)3-4-9(10)14(20)21/h3-6,19,22H,1-2H3,(H,20,21)/b16-15+.
What are the key properties of 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid?
2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid has a molecular weight of 367.34 g/mol, XLogP of 2.94, 6 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)benzoic acid is sourced from PubChem (CID 135612202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).