C17H10F5NO3 — CID 135613035
(E)-2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoic acid (PubChem CID 135613035) has the molecular formula C17H10F5NO3 and a molecular weight of 371.26 g/mol. Its IUPAC name is (E)-2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 135613035 |
| Molecular Formula | C17H10F5NO3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (E)-2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoic acid |
| SMILES | Cc1c(F)c(F)cc(F)c1/C(O)=C(/C=N/c1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C17H10F5NO3/c1-7-14(11(20)5-12(21)15(7)22)16(24)9(17(25)26)6-23-13-3-2-8(18)4-10(13)19/h2-6,24H,1H3,(H,25,26)/b16-9+,23-6+ |
| InChIKey | BSKHNKCXJQJGSK-QFDAHYNASA-N |
| XLogP | 4.45 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|