C9H7N3O2S2 — CID 135613107
5-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 135613107) has the molecular formula C9H7N3O2S2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 5-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 135613107 |
| Molecular Formula | C9H7N3O2S2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 5-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Oc1ccc(/C=N/c2n[nH]c(=S)s2)c(O)c1 |
| InChI | InChI=1S/C9H7N3O2S2/c13-6-2-1-5(7(14)3-6)4-10-8-11-12-9(15)16-8/h1-4,13-14H,(H,12,15)/b10-4+ |
| InChIKey | WTGPNYCPNFSZTG-ONNFQVAWSA-N |
| XLogP | 2.36 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|