C15H9Br2ClN4OS — CID 135613225
3-(3-chlorophenyl)-4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 135613225) has the molecular formula C15H9Br2ClN4OS and a molecular weight of 488.59 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(3-chlorophenyl)-4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135613225 |
| Molecular Formula | C15H9Br2ClN4OS |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 485.86 |
| IUPAC Name | 3-(3-chlorophenyl)-4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/n1c(-c2cccc(Cl)c2)n[nH]c1=S |
| InChI | InChI=1S/C15H9Br2ClN4OS/c16-10-4-9(13(23)12(17)6-10)7-19-22-14(20-21-15(22)24)8-2-1-3-11(18)5-8/h1-7,23H,(H,21,24)/b19-7+ |
| InChIKey | JBZHOTFQJLPXSM-FBCYGCLPSA-N |
| XLogP | 5.37 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|