C15H14N4O2S — CID 135613728
2-methoxy-6-[(E)-[(7-methylthieno[3,2-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol (PubChem CID 135613728) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-methoxy-6-[(E)-[(7-methylthieno[3,2-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-methoxy-6-[(E)-[(7-methylthieno[3,2-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135613728 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-methoxy-6-[(E)-[(7-methylthieno[3,2-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cccc(/C=N/Nc2ncnc3c(C)csc23)c1O |
| InChI | InChI=1S/C15H14N4O2S/c1-9-7-22-14-12(9)16-8-17-15(14)19-18-6-10-4-3-5-11(21-2)13(10)20/h3-8,20H,1-2H3,(H,16,17,19)/b18-6+ |
| InChIKey | WYLGLAFEMWOXNY-NGYBGAFCSA-N |
| XLogP | 3.16 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|