About 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol
4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol (PubChem CID 135615335) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol |
| PubChem CID | 135615335 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol |
| SMILES | CC(C)(C)N/N=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C11H16N2O3/c1-11(2,3)13-12-6-7-4-5-8(14)10(16)9(7)15/h4-6,13-16H,1-3H3/b12-6+ |
| InChIKey | CYRGVEROMQXFIF-WUXMJOGZSA-N |
| XLogP | 1.53 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol?
The IUPAC name of 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol (CID 135615335) is 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol.
What is the SMILES notation for 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol?
The canonical SMILES for 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol is CC(C)(C)N/N=C/c1ccc(O)c(O)c1O.
What is the InChIKey of 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol?
The InChIKey is CYRGVEROMQXFIF-WUXMJOGZSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-11(2,3)13-12-6-7-4-5-8(14)10(16)9(7)15/h4-6,13-16H,1-3H3/b12-6+.
What are the key properties of 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol?
4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol has a molecular weight of 224.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-(tert-butylhydrazinylidene)methyl]benzene-1,2,3-triol is sourced from PubChem (CID 135615335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).