C16H12Cl2N4O3 — CID 135615433
(1E)-1-[(5-cyano-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)methylidene]-3-(2,3-dichlorophenyl)urea (PubChem CID 135615433) has the molecular formula C16H12Cl2N4O3 and a molecular weight of 379.20 g/mol. Its IUPAC name is (1E)-1-[(5-cyano-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)methylidene]-3-(2,3-dichlorophenyl)urea.
| Compound Name | (1E)-1-[(5-cyano-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)methylidene]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 135615433 |
| Molecular Formula | C16H12Cl2N4O3 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | (1E)-1-[(5-cyano-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)methylidene]-3-(2,3-dichlorophenyl)urea |
| SMILES | Cc1c(/C=N/C(=O)Nc2cccc(Cl)c2Cl)c(O)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C16H12Cl2N4O3/c1-8-9(6-19)14(23)22(2)15(24)10(8)7-20-16(25)21-12-5-3-4-11(17)13(12)18/h3-5,7,24H,1-2H3,(H,21,25)/b20-7+ |
| InChIKey | DYNBBGCUSQTHNE-IFRROFPPSA-N |
| XLogP | 3.23 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|