About N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide
N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide (PubChem CID 135616060) has the molecular formula C15H11Cl2N3O4
and a molecular weight of 368.18 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide.
Molecular Properties
| Compound Name | N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide |
| PubChem CID | 135616060 |
| Molecular Formula | C15H11Cl2N3O4 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1O)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H11Cl2N3O4/c16-10-2-1-3-11(13(10)17)19-14(23)15(24)20-18-7-8-4-5-9(21)6-12(8)22/h1-7,21-22H,(H,19,23)(H,20,24)/b18-7+ |
| InChIKey | IKGXJSJPKYJPGY-CNHKJKLMSA-N |
| XLogP | 2.49 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide?
The IUPAC name of N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide (CID 135616060) is N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide.
What is the SMILES notation for N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide?
The canonical SMILES for N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide is O=C(N/N=C/c1ccc(O)cc1O)C(=O)Nc1cccc(Cl)c1Cl.
What is the InChIKey of N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide?
The InChIKey is IKGXJSJPKYJPGY-CNHKJKLMSA-N. The full InChI is InChI=1S/C15H11Cl2N3O4/c16-10-2-1-3-11(13(10)17)19-14(23)15(24)20-18-7-8-4-5-9(21)6-12(8)22/h1-7,21-22H,(H,19,23)(H,20,24)/b18-7+.
What are the key properties of N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide?
N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide has a molecular weight of 368.18 g/mol, XLogP of 2.49, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dichlorophenyl)-N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]oxamide is sourced from PubChem (CID 135616060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).