About 2-(1,3-thiazol-2-yl)phenol
2-(1,3-thiazol-2-yl)phenol (PubChem CID 135616172) has the molecular formula C9H7NOS
and a molecular weight of 177.23 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yl)phenol |
| PubChem CID | 135616172 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)phenol |
| SMILES | Oc1ccccc1-c1nccs1 |
| InChI | InChI=1S/C9H7NOS/c11-8-4-2-1-3-7(8)9-10-5-6-12-9/h1-6,11H |
| InChIKey | LOGPRZMQSREDOU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,3-thiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yl)phenol?
The IUPAC name of 2-(1,3-thiazol-2-yl)phenol (CID 135616172) is 2-(1,3-thiazol-2-yl)phenol.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)phenol?
The canonical SMILES for 2-(1,3-thiazol-2-yl)phenol is Oc1ccccc1-c1nccs1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)phenol?
The InChIKey is LOGPRZMQSREDOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NOS/c11-8-4-2-1-3-7(8)9-10-5-6-12-9/h1-6,11H.
What are the key properties of 2-(1,3-thiazol-2-yl)phenol?
2-(1,3-thiazol-2-yl)phenol has a molecular weight of 177.23 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)phenol is sourced from PubChem (CID 135616172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).