About carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene
carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene (PubChem CID 135616763) has the molecular formula C8H12Cl2IN2S+
and a molecular weight of 366.08 g/mol. Its IUPAC name is carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene |
| PubChem CID | 135616763 |
| Molecular Formula | C8H12Cl2IN2S+ |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 364.91 |
| IUPAC Name | carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene |
| SMILES | CC1(Cl)C=CC=C(Cl)C1I.NC([NH3+])=S |
| InChI | InChI=1S/C7H7Cl2I.CH4N2S/c1-7(9)4-2-3-5(8)6(7)10;2-1(3)4/h2-4,6H,1H3;(H4,2,3,4)/p+1 |
| InChIKey | YBIIPFWSUNHDMD-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene?
The IUPAC name of carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene (CID 135616763) is carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene.
What is the SMILES notation for carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene?
The canonical SMILES for carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene is CC1(Cl)C=CC=C(Cl)C1I.NC([NH3+])=S.
What is the InChIKey of carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene?
The InChIKey is YBIIPFWSUNHDMD-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H7Cl2I.CH4N2S/c1-7(9)4-2-3-5(8)6(7)10;2-1(3)4/h2-4,6H,1H3;(H4,2,3,4)/p+1.
What are the key properties of carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene?
carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene has a molecular weight of 366.08 g/mol, XLogP of 1.95, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioylazanium;1,5-dichloro-6-iodo-5-methylcyclohexa-1,3-diene is sourced from PubChem (CID 135616763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).