C19H25N3O3 — CID 135616981
methyl (6S)-3-(2-methoxyethyl)-4-methyl-6-phenyl-2-prop-2-enylimino-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 135616981) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is methyl (6S)-3-(2-methoxyethyl)-4-methyl-6-phenyl-2-prop-2-enylimino-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (6S)-3-(2-methoxyethyl)-4-methyl-6-phenyl-2-prop-2-enylimino-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135616981 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | methyl (6S)-3-(2-methoxyethyl)-4-methyl-6-phenyl-2-prop-2-enylimino-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | C=CC/N=C1/N[C@@H](c2ccccc2)C(C(=O)OC)=C(C)N1CCOC |
| InChI | InChI=1S/C19H25N3O3/c1-5-11-20-19-21-17(15-9-7-6-8-10-15)16(18(23)25-4)14(2)22(19)12-13-24-3/h5-10,17H,1,11-13H2,2-4H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | IEVFHLVLBVQGHO-KRWDZBQOSA-N |
| XLogP | 2.27 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|