C20H17N5O2S — CID 135617406
2-[(1R)-1-(6-amino-4-oxo-1-phenylpyrimidin-2-yl)sulfanylethyl]-3H-quinazolin-4-one (PubChem CID 135617406) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is 2-[(1R)-1-(6-amino-4-oxo-1-phenylpyrimidin-2-yl)sulfanylethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-(6-amino-4-oxo-1-phenylpyrimidin-2-yl)sulfanylethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135617406 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[(1R)-1-(6-amino-4-oxo-1-phenylpyrimidin-2-yl)sulfanylethyl]-3H-quinazolin-4-one |
| SMILES | C[C@@H](Sc1nc(=O)cc(N)n1-c1ccccc1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H17N5O2S/c1-12(18-22-15-10-6-5-9-14(15)19(27)24-18)28-20-23-17(26)11-16(21)25(20)13-7-3-2-4-8-13/h2-12H,21H2,1H3,(H,22,24,27)/t12-/m1/s1 |
| InChIKey | ZDURLRCVIOLVKZ-GFCCVEGCSA-N |
| XLogP | 2.90 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |