C16H15BrN4 — CID 135617470
4-(2-bromophenyl)-5-isocyano-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 135617470) has the molecular formula C16H15BrN4 and a molecular weight of 343.23 g/mol. Its IUPAC name is 4-(2-bromophenyl)-5-isocyano-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(2-bromophenyl)-5-isocyano-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 135617470 |
| Molecular Formula | C16H15BrN4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4-(2-bromophenyl)-5-isocyano-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1=C(CCC)Nc2[nH]ncc2C1c1ccccc1Br |
| InChI | InChI=1S/C16H15BrN4/c1-3-6-13-15(18-2)14(10-7-4-5-8-12(10)17)11-9-19-21-16(11)20-13/h4-5,7-9,14H,3,6H2,1H3,(H2,19,20,21) |
| InChIKey | VSOYMPUHCCOCSF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 45.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|