C22H25ClN4 — CID 135617496
4-(2-chlorophenyl)-3-cyclohexyl-5-isocyano-6-propyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine (PubChem CID 135617496) has the molecular formula C22H25ClN4 and a molecular weight of 380.92 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-3-cyclohexyl-5-isocyano-6-propyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 4-(2-chlorophenyl)-3-cyclohexyl-5-isocyano-6-propyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 135617496 |
| Molecular Formula | C22H25ClN4 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-(2-chlorophenyl)-3-cyclohexyl-5-isocyano-6-propyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine |
| SMILES | [C-]#[N+]C1=C(CCC)Nc2n[nH]c(C3CCCCC3)c2C1c1ccccc1Cl |
| InChI | InChI=1S/C22H25ClN4/c1-3-9-17-21(24-2)18(15-12-7-8-13-16(15)23)19-20(26-27-22(19)25-17)14-10-5-4-6-11-14/h7-8,12-14,18H,3-6,9-11H2,1H3,(H2,25,26,27) |
| InChIKey | YULQUXAYZCKGMJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 45.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|