C17H15N5 — CID 135617504
2-(5-isocyano-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)benzonitrile (PubChem CID 135617504) has the molecular formula C17H15N5 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-(5-isocyano-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)benzonitrile.
| Compound Name | 2-(5-isocyano-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 135617504 |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(5-isocyano-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)benzonitrile |
| SMILES | [C-]#[N+]C1=C(CCC)Nc2[nH]ncc2C1c1ccccc1C#N |
| InChI | InChI=1S/C17H15N5/c1-3-6-14-16(19-2)15(13-10-20-22-17(13)21-14)12-8-5-4-7-11(12)9-18/h4-5,7-8,10,15H,3,6H2,1H3,(H2,20,21,22) |
| InChIKey | CKCIUGGVCJLXPB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|