C15H15ClN4 — CID 135617512
4-(6-chlorocyclohexa-1,3-dien-1-yl)-6-ethyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 135617512) has the molecular formula C15H15ClN4 and a molecular weight of 286.77 g/mol. Its IUPAC name is 4-(6-chlorocyclohexa-1,3-dien-1-yl)-6-ethyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(6-chlorocyclohexa-1,3-dien-1-yl)-6-ethyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 135617512 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-(6-chlorocyclohexa-1,3-dien-1-yl)-6-ethyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1=C(CC)Nc2[nH]ncc2C1C1=CC=CCC1Cl |
| InChI | InChI=1S/C15H15ClN4/c1-3-12-14(17-2)13(9-6-4-5-7-11(9)16)10-8-18-20-15(10)19-12/h4-6,8,11,13H,3,7H2,1H3,(H2,18,19,20) |
| InChIKey | QZOYMYCSUDDDPY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|