C16H17N5 — CID 135617567
5-isocyano-4-(6-methyl-2-pyridinyl)-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 135617567) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 5-isocyano-4-(6-methyl-2-pyridinyl)-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 5-isocyano-4-(6-methyl-2-pyridinyl)-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 135617567 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 5-isocyano-4-(6-methyl-2-pyridinyl)-6-propyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1=C(CCC)Nc2[nH]ncc2C1c1cccc(C)n1 |
| InChI | InChI=1S/C16H17N5/c1-4-6-13-15(17-3)14(11-9-18-21-16(11)20-13)12-8-5-7-10(2)19-12/h5,7-9,14H,4,6H2,1-2H3,(H2,18,20,21) |
| InChIKey | LFUOEPOLCXULIM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|