C20H14ClF3N4 — CID 135617670
4-[6-chloro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-5-isocyano-6-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 135617670) has the molecular formula C20H14ClF3N4 and a molecular weight of 402.81 g/mol. Its IUPAC name is 4-[6-chloro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-5-isocyano-6-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-[6-chloro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-5-isocyano-6-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 135617670 |
| Molecular Formula | C20H14ClF3N4 |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 4-[6-chloro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-5-isocyano-6-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1=C(c2ccccc2)Nc2[nH]ncc2C1C1=CC=CC(C(F)(F)F)C1Cl |
| InChI | InChI=1S/C20H14ClF3N4/c1-25-18-15(12-8-5-9-14(16(12)21)20(22,23)24)13-10-26-28-19(13)27-17(18)11-6-3-2-4-7-11/h2-10,14-16H,(H2,26,27,28) |
| InChIKey | FZMXIXQJLRCNAH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|