C16H14BrN5 — CID 135617676
6-bromo-5-(6-ethyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)cyclohexa-2,4-diene-1-carbonitrile (PubChem CID 135617676) has the molecular formula C16H14BrN5 and a molecular weight of 356.23 g/mol. Its IUPAC name is 6-bromo-5-(6-ethyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)cyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 6-bromo-5-(6-ethyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)cyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 135617676 |
| Molecular Formula | C16H14BrN5 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 6-bromo-5-(6-ethyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)cyclohexa-2,4-diene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(CC)Nc2[nH]ncc2C1C1=CC=CC(C#N)C1Br |
| InChI | InChI=1S/C16H14BrN5/c1-3-12-15(19-2)13(11-8-20-22-16(11)21-12)10-6-4-5-9(7-18)14(10)17/h4-6,8-9,13-14H,3H2,1H3,(H2,20,21,22) |
| InChIKey | KUCHIIUYNSZFET-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|