C23H29NO3 — CID 135618045
(1R,2S)-2-[(2S)-1-[(2-hydroxyphenyl)methylideneamino]propan-2-yl]-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 135618045) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (1R,2S)-2-[(2S)-1-[(2-hydroxyphenyl)methylideneamino]propan-2-yl]-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R,2S)-2-[(2S)-1-[(2-hydroxyphenyl)methylideneamino]propan-2-yl]-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 135618045 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (1R,2S)-2-[(2S)-1-[(2-hydroxyphenyl)methylideneamino]propan-2-yl]-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | COc1cc(C)c2c(c1C)[C@H](O)[C@H]([C@H](C)C/N=C/c1ccccc1O)CC2 |
| InChI | InChI=1S/C23H29NO3/c1-14-11-21(27-4)16(3)22-18(14)9-10-19(23(22)26)15(2)12-24-13-17-7-5-6-8-20(17)25/h5-8,11,13,15,19,23,25-26H,9-10,12H2,1-4H3/b24-13+/t15-,19+,23-/m1/s1 |
| InChIKey | RCAURQSZEKNVTD-PKIOKFKUSA-N |
| XLogP | 4.37 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|