About 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one
4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one (PubChem CID 135618156) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one.
Molecular Properties
| Compound Name | 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one |
| PubChem CID | 135618156 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one |
| SMILES | CCNc1nc(C)[nH]c(=O)n1 |
| InChI | InChI=1S/C6H10N4O/c1-3-7-5-8-4(2)9-6(11)10-5/h3H2,1-2H3,(H2,7,8,9,10,11) |
| InChIKey | QGZBIYWLPWSMQC-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one?
The IUPAC name of 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one (CID 135618156) is 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one.
What is the SMILES notation for 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one?
The canonical SMILES for 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one is CCNc1nc(C)[nH]c(=O)n1.
What is the InChIKey of 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one?
The InChIKey is QGZBIYWLPWSMQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-3-7-5-8-4(2)9-6(11)10-5/h3H2,1-2H3,(H2,7,8,9,10,11).
What are the key properties of 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one?
4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one has a molecular weight of 154.17 g/mol, XLogP of -0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-6-methyl-1H-1,3,5-triazin-2-one is sourced from PubChem (CID 135618156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).