C24H27N5O4 — CID 135618830
7-(2,3-dimethoxyphenyl)-2-(3-hydroxypropyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135618830) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 7-(2,3-dimethoxyphenyl)-2-(3-hydroxypropyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,3-dimethoxyphenyl)-2-(3-hydroxypropyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135618830 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 7-(2,3-dimethoxyphenyl)-2-(3-hydroxypropyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cccc(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nc(CCCO)nn32)c1OC |
| InChI | InChI=1S/C24H27N5O4/c1-15-20(23(31)26-16-9-5-4-6-10-16)21(17-11-7-12-18(32-2)22(17)33-3)29-24(25-15)27-19(28-29)13-8-14-30/h4-7,9-12,21,30H,8,13-14H2,1-3H3,(H,26,31)(H,25,27,28) |
| InChIKey | UIBWJQXTZBIPLM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |