C11H8N6S — CID 135619982
4-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11-hexaene-14-thione (PubChem CID 135619982) has the molecular formula C11H8N6S and a molecular weight of 256.29 g/mol. Its IUPAC name is 4-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11-hexaene-14-thione.
| Compound Name | 4-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11-hexaene-14-thione |
|---|---|
| PubChem CID | 135619982 |
| Molecular Formula | C11H8N6S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11-hexaene-14-thione |
| SMILES | Cc1ccc2[nH]c3nc4n[nH]c(=S)n4nc3c2c1 |
| InChI | InChI=1S/C11H8N6S/c1-5-2-3-7-6(4-5)8-9(12-7)13-10-14-15-11(18)17(10)16-8/h2-4H,1H3,(H,15,18)(H,12,13,14) |
| InChIKey | PRUOUYBWISMUNV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|