C27H27N3O2 — CID 135620342
2-(5-methyl-2-propan-2-ylphenoxy)-N-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide (PubChem CID 135620342) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylphenoxy)-N-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(5-methyl-2-propan-2-ylphenoxy)-N-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135620342 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylphenoxy)-N-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)N/N=C/c2c(-c3ccccc3)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C27H27N3O2/c1-18(2)21-14-13-19(3)15-25(21)32-17-26(31)30-28-16-23-22-11-7-8-12-24(22)29-27(23)20-9-5-4-6-10-20/h4-16,18,29H,17H2,1-3H3,(H,30,31)/b28-16+ |
| InChIKey | VDCYONNZFARBID-LQKURTRISA-N |
| XLogP | 5.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|