C19H20N4OS — CID 135620460
1-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 135620460) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 135620460 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | Cc1cccc2c(/N=N/C(=S)Nc3ccc(C(C)C)cc3)c(O)[nH]c12 |
| InChI | InChI=1S/C19H20N4OS/c1-11(2)13-7-9-14(10-8-13)20-19(25)23-22-17-15-6-4-5-12(3)16(15)21-18(17)24/h4-11,21,24H,1-3H3,(H,20,25)/b23-22+ |
| InChIKey | VCHLGWIDWRXOSS-GHVJWSGMSA-N |
| XLogP | 5.79 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|