C20H14N6O5 — CID 135620625
15-amino-11-(4-hydroxy-3-nitrophenyl)-8,14,16,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17),15-hexaene-9,13-dione (PubChem CID 135620625) has the molecular formula C20H14N6O5 and a molecular weight of 418.37 g/mol. Its IUPAC name is 15-amino-11-(4-hydroxy-3-nitrophenyl)-8,14,16,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17),15-hexaene-9,13-dione.
| Compound Name | 15-amino-11-(4-hydroxy-3-nitrophenyl)-8,14,16,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17),15-hexaene-9,13-dione |
|---|---|
| PubChem CID | 135620625 |
| Molecular Formula | C20H14N6O5 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 15-amino-11-(4-hydroxy-3-nitrophenyl)-8,14,16,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17),15-hexaene-9,13-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)C(c1ccc(O)c([N+](=O)[O-])c1)c1c(c3ccccc3[nH]c1=O)N2 |
| InChI | InChI=1S/C20H14N6O5/c21-20-24-17-15(19(29)25-20)13(8-5-6-12(27)11(7-8)26(30)31)14-16(23-17)9-3-1-2-4-10(9)22-18(14)28/h1-7,13,27H,(H,22,28)(H4,21,23,24,25,29) |
| InChIKey | NPYKNKDJYXFSQT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 180.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|