C6H7ClN4O — CID 135621439
1-chloro-5-methyl-2,3-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 135621439) has the molecular formula C6H7ClN4O and a molecular weight of 186.60 g/mol. Its IUPAC name is 1-chloro-5-methyl-2,3-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 1-chloro-5-methyl-2,3-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 135621439 |
| Molecular Formula | C6H7ClN4O |
| Molecular Weight | 186.60 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 1-chloro-5-methyl-2,3-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2c(n1)NCN2Cl |
| InChI | InChI=1S/C6H7ClN4O/c1-4-2-5(12)11-6(9-4)8-3-10(11)7/h2H,3H2,1H3,(H,8,9) |
| InChIKey | WRNHOFXQGJMVFA-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.60 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|