C21H16BrClN4OS — CID 135621591
4-bromo-3-chloro-N-[(E)-[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 135621591) has the molecular formula C21H16BrClN4OS and a molecular weight of 487.81 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-[(E)-[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-bromo-3-chloro-N-[(E)-[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135621591 |
| Molecular Formula | C21H16BrClN4OS |
| Molecular Weight | 487.81 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | 4-bromo-3-chloro-N-[(E)-[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | CCc1ccc(-c2[nH]ncc2/C=N/NC(=O)c2sc3cccc(Br)c3c2Cl)cc1 |
| InChI | InChI=1S/C21H16BrClN4OS/c1-2-12-6-8-13(9-7-12)19-14(10-24-26-19)11-25-27-21(28)20-18(23)17-15(22)4-3-5-16(17)29-20/h3-11H,2H2,1H3,(H,24,26)(H,27,28)/b25-11+ |
| InChIKey | QXCRUTZENIROGE-OPEKNORGSA-N |
| XLogP | 6.03 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|