C17H23BrN2O — CID 135623708
2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]-6-bromophenol (PubChem CID 135623708) has the molecular formula C17H23BrN2O and a molecular weight of 351.29 g/mol. Its IUPAC name is 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]-6-bromophenol.
| Compound Name | 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]-6-bromophenol |
|---|---|
| PubChem CID | 135623708 |
| Molecular Formula | C17H23BrN2O |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]-6-bromophenol |
| SMILES | Oc1c(Br)cccc1/C=N/C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C17H23BrN2O/c18-15-7-3-5-14(17(15)21)12-19-11-13-6-4-10-20-9-2-1-8-16(13)20/h3,5,7,12-13,16,21H,1-2,4,6,8-11H2/b19-12+/t13-,16+/m0/s1 |
| InChIKey | NICFMMXVUWIJMR-LOLXLMDRSA-N |
| XLogP | 3.84 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|