C10H10N4O3 — CID 135624029
1,4-dioxido-7-prop-2-enoxy-1,2,4-benzotriazine-1,4-diium-3-amine (PubChem CID 135624029) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 1,4-dioxido-7-prop-2-enoxy-1,2,4-benzotriazine-1,4-diium-3-amine.
| Compound Name | 1,4-dioxido-7-prop-2-enoxy-1,2,4-benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135624029 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1,4-dioxido-7-prop-2-enoxy-1,2,4-benzotriazine-1,4-diium-3-amine |
| SMILES | C=CCOc1ccc2c(c1)[n+]([O-])nc(N)[n+]2[O-] |
| InChI | InChI=1S/C10H10N4O3/c1-2-5-17-7-3-4-8-9(6-7)14(16)12-10(11)13(8)15/h2-4,6H,1,5H2,(H2,11,12) |
| InChIKey | IUPORFAQZFESQW-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|