C13H8ClN3O3S — CID 135624475
7-chloro-6-nitro-5-phenyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one (PubChem CID 135624475) has the molecular formula C13H8ClN3O3S and a molecular weight of 321.75 g/mol. Its IUPAC name is 7-chloro-6-nitro-5-phenyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one.
| Compound Name | 7-chloro-6-nitro-5-phenyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 135624475 |
| Molecular Formula | C13H8ClN3O3S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 7-chloro-6-nitro-5-phenyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2)c2c(sc(Cl)c2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C13H8ClN3O3S/c14-12-11(17(19)20)9-10(7-4-2-1-3-5-7)15-6-8(18)16-13(9)21-12/h1-5H,6H2,(H,16,18) |
| InChIKey | DXMDSHLTBVNSCQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|