About 6-chloro-2,3-dihydroxynaphthalene-1,4-dione
6-chloro-2,3-dihydroxynaphthalene-1,4-dione (PubChem CID 135625282) has the molecular formula C10H5ClO4
and a molecular weight of 224.60 g/mol. Its IUPAC name is 6-chloro-2,3-dihydroxynaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 6-chloro-2,3-dihydroxynaphthalene-1,4-dione |
| PubChem CID | 135625282 |
| Molecular Formula | C10H5ClO4 |
| Molecular Weight | 224.60 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 6-chloro-2,3-dihydroxynaphthalene-1,4-dione |
| SMILES | O=C1C(O)=C(O)C(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H5ClO4/c11-4-1-2-5-6(3-4)8(13)10(15)9(14)7(5)12/h1-3,14-15H |
| InChIKey | QLHIGRZXEPMGMR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.60 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,3-dihydroxynaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3-dihydroxynaphthalene-1,4-dione?
The IUPAC name of 6-chloro-2,3-dihydroxynaphthalene-1,4-dione (CID 135625282) is 6-chloro-2,3-dihydroxynaphthalene-1,4-dione.
What is the SMILES notation for 6-chloro-2,3-dihydroxynaphthalene-1,4-dione?
The canonical SMILES for 6-chloro-2,3-dihydroxynaphthalene-1,4-dione is O=C1C(O)=C(O)C(=O)c2cc(Cl)ccc21.
What is the InChIKey of 6-chloro-2,3-dihydroxynaphthalene-1,4-dione?
The InChIKey is QLHIGRZXEPMGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClO4/c11-4-1-2-5-6(3-4)8(13)10(15)9(14)7(5)12/h1-3,14-15H.
What are the key properties of 6-chloro-2,3-dihydroxynaphthalene-1,4-dione?
6-chloro-2,3-dihydroxynaphthalene-1,4-dione has a molecular weight of 224.60 g/mol, XLogP of 2.05, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3-dihydroxynaphthalene-1,4-dione is sourced from PubChem (CID 135625282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).