About 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione
2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione (PubChem CID 135625294) has the molecular formula C6H7N5O2
and a molecular weight of 181.16 g/mol. Its IUPAC name is 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione.
Molecular Properties
| Compound Name | 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione |
| PubChem CID | 135625294 |
| Molecular Formula | C6H7N5O2 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione |
| SMILES | CNc1nc2[nH]c(=O)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C6H7N5O2/c1-7-5-9-3-2(4(12)11-5)8-6(13)10-3/h1H3,(H4,7,8,9,10,11,12,13) |
| InChIKey | CVOMRGUGVVOEDQ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione?
The IUPAC name of 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione (CID 135625294) is 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione.
What is the SMILES notation for 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione?
The canonical SMILES for 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione is CNc1nc2[nH]c(=O)[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione?
The InChIKey is CVOMRGUGVVOEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O2/c1-7-5-9-3-2(4(12)11-5)8-6(13)10-3/h1H3,(H4,7,8,9,10,11,12,13).
What are the key properties of 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione?
2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione has a molecular weight of 181.16 g/mol, XLogP of -1.02, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-7,9-dihydro-1H-purine-6,8-dione is sourced from PubChem (CID 135625294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).