C12H9Cl2N5O — CID 135625355
2-[(3,4-dichlorophenyl)methylamino]-1,7-dihydropurin-6-one (PubChem CID 135625355) has the molecular formula C12H9Cl2N5O and a molecular weight of 310.14 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-1,7-dihydropurin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135625355 |
| Molecular Formula | C12H9Cl2N5O |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(NCc2ccc(Cl)c(Cl)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H9Cl2N5O/c13-7-2-1-6(3-8(7)14)4-15-12-18-10-9(11(20)19-12)16-5-17-10/h1-3,5H,4H2,(H3,15,16,17,18,19,20) |
| InChIKey | JSCNOJMNXGDROK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |