About 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one
5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 135626423) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 135626423 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | COc1cccc(-c2nc3c(C)nn(C)c3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C14H14N4O2/c1-8-11-12(18(2)17-8)14(19)16-13(15-11)9-5-4-6-10(7-9)20-3/h4-7H,1-3H3,(H,15,16,19) |
| InChIKey | PNODNVAYKJMAJQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CID 135626423) is 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is COc1cccc(-c2nc3c(C)nn(C)c3c(=O)[nH]2)c1.
What is the InChIKey of 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The InChIKey is PNODNVAYKJMAJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2/c1-8-11-12(18(2)17-8)14(19)16-13(15-11)9-5-4-6-10(7-9)20-3/h4-7H,1-3H3,(H,15,16,19).
What are the key properties of 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one has a molecular weight of 270.29 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methoxyphenyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 135626423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).