C13H11N5O3 — CID 135626430
1,3-dimethyl-5-(4-nitrophenyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 135626430) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4-nitrophenyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 1,3-dimethyl-5-(4-nitrophenyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135626430 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 1,3-dimethyl-5-(4-nitrophenyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1nn(C)c2c(=O)[nH]c(-c3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C13H11N5O3/c1-7-10-11(17(2)16-7)13(19)15-12(14-10)8-3-5-9(6-4-8)18(20)21/h3-6H,1-2H3,(H,14,15,19) |
| InChIKey | XRFNWIDKRBAUKH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|