About 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile
2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile (PubChem CID 135627049) has the molecular formula C15H11F3N4O2
and a molecular weight of 336.27 g/mol. Its IUPAC name is 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile |
| PubChem CID | 135627049 |
| Molecular Formula | C15H11F3N4O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(C)c(=O)c1/N=N/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11F3N4O2/c1-8-11(7-19)13(23)22(2)14(24)12(8)21-20-10-5-3-9(4-6-10)15(16,17)18/h3-6,23H,1-2H3/b21-20+ |
| InChIKey | SWVXOKLCSOFEHI-QZQOTICOSA-N |
| XLogP | 3.71 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile?
The IUPAC name of 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile (CID 135627049) is 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile.
What is the SMILES notation for 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile?
The canonical SMILES for 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile is Cc1c(C#N)c(O)n(C)c(=O)c1/N=N/c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile?
The InChIKey is SWVXOKLCSOFEHI-QZQOTICOSA-N. The full InChI is InChI=1S/C15H11F3N4O2/c1-8-11(7-19)13(23)22(2)14(24)12(8)21-20-10-5-3-9(4-6-10)15(16,17)18/h3-6,23H,1-2H3/b21-20+.
What are the key properties of 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile?
2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile has a molecular weight of 336.27 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,4-dimethyl-6-oxo-5-[[4-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile is sourced from PubChem (CID 135627049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).