About 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol
5-(2H-tetrazol-5-yl)benzene-1,2,3-triol (PubChem CID 135629267) has the molecular formula C7H6N4O3
and a molecular weight of 194.15 g/mol. Its IUPAC name is 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol |
| PubChem CID | 135629267 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol |
| SMILES | Oc1cc(-c2nn[nH]n2)cc(O)c1O |
| InChI | InChI=1S/C7H6N4O3/c12-4-1-3(2-5(13)6(4)14)7-8-10-11-9-7/h1-2,12-14H,(H,8,9,10,11) |
| InChIKey | BKOFIXXJDYWOBK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol?
The IUPAC name of 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol (CID 135629267) is 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol.
What is the SMILES notation for 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol?
The canonical SMILES for 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol is Oc1cc(-c2nn[nH]n2)cc(O)c1O.
What is the InChIKey of 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol?
The InChIKey is BKOFIXXJDYWOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O3/c12-4-1-3(2-5(13)6(4)14)7-8-10-11-9-7/h1-2,12-14H,(H,8,9,10,11).
What are the key properties of 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol?
5-(2H-tetrazol-5-yl)benzene-1,2,3-triol has a molecular weight of 194.15 g/mol, XLogP of -0.02, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2H-tetrazol-5-yl)benzene-1,2,3-triol is sourced from PubChem (CID 135629267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).