C11H12N6OS — CID 135629828
1-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]-3-phenylthiourea (PubChem CID 135629828) has the molecular formula C11H12N6OS and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]-3-phenylthiourea.
| Compound Name | 1-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 135629828 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]-3-phenylthiourea |
| SMILES | Cc1nnc(NNC(=S)Nc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C11H12N6OS/c1-7-9(18)13-10(15-14-7)16-17-11(19)12-8-5-3-2-4-6-8/h2-6H,1H3,(H2,12,17,19)(H2,13,15,16,18) |
| InChIKey | YUTZQXPYMGKETM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_G(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|