C16H16N4OS — CID 135630035
2-piperidin-1-yl-5-thiophen-3-yl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135630035) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 2-piperidin-1-yl-5-thiophen-3-yl-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-piperidin-1-yl-5-thiophen-3-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135630035 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-piperidin-1-yl-5-thiophen-3-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(N2CCCCC2)nc2nccc(-c3ccsc3)c12 |
| InChI | InChI=1S/C16H16N4OS/c21-15-13-12(11-5-9-22-10-11)4-6-17-14(13)18-16(19-15)20-7-2-1-3-8-20/h4-6,9-10H,1-3,7-8H2,(H,17,18,19,21) |
| InChIKey | LKOXLJGHJJOFIY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |