C20H19ClN4O3S3 — CID 135630347
2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]acetamide (PubChem CID 135630347) has the molecular formula C20H19ClN4O3S3 and a molecular weight of 495.05 g/mol. Its IUPAC name is 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 135630347 |
| Molecular Formula | C20H19ClN4O3S3 |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]acetamide |
| SMILES | COc1cc(/C(C)=N\NC(=O)CSc2nnc(SCc3ccc(Cl)cc3)s2)ccc1O |
| InChI | InChI=1S/C20H19ClN4O3S3/c1-12(14-5-8-16(26)17(9-14)28-2)22-23-18(27)11-30-20-25-24-19(31-20)29-10-13-3-6-15(21)7-4-13/h3-9,26H,10-11H2,1-2H3,(H,23,27)/b22-12- |
| InChIKey | NDKAIUUVANFQMC-UUYOSTAYSA-N |
| XLogP | 4.83 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|