C16H12Br2N4OS — CID 135630644
4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135630644) has the molecular formula C16H12Br2N4OS and a molecular weight of 468.17 g/mol. Its IUPAC name is 4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135630644 |
| Molecular Formula | C16H12Br2N4OS |
| Molecular Weight | 468.17 g/mol |
| Exact Mass | 465.91 |
| IUPAC Name | 4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2/N=C/c2cc(Br)cc(Br)c2O)c1 |
| InChI | InChI=1S/C16H12Br2N4OS/c1-9-3-2-4-10(5-9)15-20-21-16(24)22(15)19-8-11-6-12(17)7-13(18)14(11)23/h2-8,23H,1H3,(H,21,24)/b19-8+ |
| InChIKey | IQSRJWLYFOYWJY-UFWORHAWSA-N |
| XLogP | 5.03 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.17 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|