C19H24N4O3 — CID 135630848
tert-butyl N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)pyrrolidin-3-yl]carbamate (PubChem CID 135630848) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is tert-butyl N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 135630848 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | tert-butyl N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2nc(-c3ccccc3)cc(=O)[nH]2)C1 |
| InChI | InChI=1S/C19H24N4O3/c1-19(2,3)26-18(25)20-14-9-10-23(12-14)17-21-15(11-16(24)22-17)13-7-5-4-6-8-13/h4-8,11,14H,9-10,12H2,1-3H3,(H,20,25)(H,21,22,24) |
| InChIKey | RNKMXZABEILKJM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |