About 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide
2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide (PubChem CID 135631702) has the molecular formula C16H10F2N2O3
and a molecular weight of 316.26 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide |
| PubChem CID | 135631702 |
| Molecular Formula | C16H10F2N2O3 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide |
| SMILES | NC(=O)c1cc2ccc(O)cc2o/c1=N\c1ccc(F)cc1F |
| InChI | InChI=1S/C16H10F2N2O3/c17-9-2-4-13(12(18)6-9)20-16-11(15(19)22)5-8-1-3-10(21)7-14(8)23-16/h1-7,21H,(H2,19,22)/b20-16- |
| InChIKey | XPFUJQYMUBPSCK-SILNSSARSA-N |
| XLogP | 2.75 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide?
The IUPAC name of 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide (CID 135631702) is 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide.
What is the SMILES notation for 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide?
The canonical SMILES for 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide is NC(=O)c1cc2ccc(O)cc2o/c1=N\c1ccc(F)cc1F.
What is the InChIKey of 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide?
The InChIKey is XPFUJQYMUBPSCK-SILNSSARSA-N. The full InChI is InChI=1S/C16H10F2N2O3/c17-9-2-4-13(12(18)6-9)20-16-11(15(19)22)5-8-1-3-10(21)7-14(8)23-16/h1-7,21H,(H2,19,22)/b20-16-.
What are the key properties of 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide?
2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide has a molecular weight of 316.26 g/mol, XLogP of 2.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)imino-7-hydroxychromene-3-carboxamide is sourced from PubChem (CID 135631702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).