C23H13F4N3O2S — CID 135633251
4-[4-(difluoromethoxy)phenyl]-11-(difluoromethyl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 135633251) has the molecular formula C23H13F4N3O2S and a molecular weight of 471.44 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-11-(difluoromethyl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-11-(difluoromethyl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 135633251 |
| Molecular Formula | C23H13F4N3O2S |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-11-(difluoromethyl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | O=c1[nH]c(-c2ccc(OC(F)F)cc2)nc2c1sc1nc(C(F)F)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C23H13F4N3O2S/c24-19(25)15-10-14(11-4-2-1-3-5-11)16-17-18(33-22(16)28-15)21(31)30-20(29-17)12-6-8-13(9-7-12)32-23(26)27/h1-10,19,23H,(H,29,30,31) |
| InChIKey | BGPCLOYIUSHCHZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |