C26H21N5O3 — CID 135633551
methyl 4-[11-(4-methylphenyl)-8-oxa-12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl]benzoate (PubChem CID 135633551) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is methyl 4-[11-(4-methylphenyl)-8-oxa-12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl]benzoate.
| Compound Name | methyl 4-[11-(4-methylphenyl)-8-oxa-12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl]benzoate |
|---|---|
| PubChem CID | 135633551 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | methyl 4-[11-(4-methylphenyl)-8-oxa-12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2Oc3ccccc3C3=C2C(c2ccc(C)cc2)n2nnnc2N3)cc1 |
| InChI | InChI=1S/C26H21N5O3/c1-15-7-9-16(10-8-15)23-21-22(27-26-28-29-30-31(23)26)19-5-3-4-6-20(19)34-24(21)17-11-13-18(14-12-17)25(32)33-2/h3-14,23-24H,1-2H3,(H,27,28,30) |
| InChIKey | XKPUIJRIKWCPBD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |