About 3-benzylsulfanyl-4H-1,2,4-triazin-5-one
3-benzylsulfanyl-4H-1,2,4-triazin-5-one (PubChem CID 135633868) has the molecular formula C10H9N3OS
and a molecular weight of 219.27 g/mol. Its IUPAC name is 3-benzylsulfanyl-4H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 3-benzylsulfanyl-4H-1,2,4-triazin-5-one |
| PubChem CID | 135633868 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 3-benzylsulfanyl-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(SCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C10H9N3OS/c14-9-6-11-13-10(12-9)15-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,12,13,14) |
| InChIKey | NWXGZONMDISUET-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzylsulfanyl-4H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylsulfanyl-4H-1,2,4-triazin-5-one?
The IUPAC name of 3-benzylsulfanyl-4H-1,2,4-triazin-5-one (CID 135633868) is 3-benzylsulfanyl-4H-1,2,4-triazin-5-one.
What is the SMILES notation for 3-benzylsulfanyl-4H-1,2,4-triazin-5-one?
The canonical SMILES for 3-benzylsulfanyl-4H-1,2,4-triazin-5-one is O=c1cnnc(SCc2ccccc2)[nH]1.
What is the InChIKey of 3-benzylsulfanyl-4H-1,2,4-triazin-5-one?
The InChIKey is NWXGZONMDISUET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3OS/c14-9-6-11-13-10(12-9)15-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,12,13,14).
What are the key properties of 3-benzylsulfanyl-4H-1,2,4-triazin-5-one?
3-benzylsulfanyl-4H-1,2,4-triazin-5-one has a molecular weight of 219.27 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylsulfanyl-4H-1,2,4-triazin-5-one is sourced from PubChem (CID 135633868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).